C20H25NO6 — CID 59187940
dimethyl (E,2S,7R)-2-benzamido-7-(2-oxopropyl)oct-4-enedioate (PubChem CID 59187940) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is dimethyl (E,2S,7R)-2-benzamido-7-(2-oxopropyl)oct-4-enedioate.
| Compound Name | dimethyl (E,2S,7R)-2-benzamido-7-(2-oxopropyl)oct-4-enedioate |
|---|---|
| PubChem CID | 59187940 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | dimethyl (E,2S,7R)-2-benzamido-7-(2-oxopropyl)oct-4-enedioate |
| SMILES | COC(=O)[C@H](C/C=C/C[C@H](NC(=O)c1ccccc1)C(=O)OC)CC(C)=O |
| InChI | InChI=1S/C20H25NO6/c1-14(22)13-16(19(24)26-2)11-7-8-12-17(20(25)27-3)21-18(23)15-9-5-4-6-10-15/h4-10,16-17H,11-13H2,1-3H3,(H,21,23)/b8-7+/t16-,17+/m1/s1 |
| InChIKey | YWGJCVXNTNRQKA-PWHGLLLSSA-N |
| XLogP | 2.06 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|