C13H16N2O4S2 — CID 132564669
methyl (2S)-3-[(2-amino-2-oxoethyl)disulfanyl]-2-benzamidopropanoate (PubChem CID 132564669) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is methyl (2S)-3-[(2-amino-2-oxoethyl)disulfanyl]-2-benzamidopropanoate.
| Compound Name | methyl (2S)-3-[(2-amino-2-oxoethyl)disulfanyl]-2-benzamidopropanoate |
|---|---|
| PubChem CID | 132564669 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | methyl (2S)-3-[(2-amino-2-oxoethyl)disulfanyl]-2-benzamidopropanoate |
| SMILES | COC(=O)[C@@H](CSSCC(N)=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O4S2/c1-19-13(18)10(7-20-21-8-11(14)16)15-12(17)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H2,14,16)(H,15,17)/t10-/m1/s1 |
| InChIKey | SSZDPNODKNBCIX-SNVBAGLBSA-N |
| XLogP | 0.82 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|