C23H26N2O6S2 — CID 71498091
3-[(2-benzamido-3-ethoxy-3-oxopropyl)disulfanyl]-2-[(2-phenylacetyl)amino]propanoic acid (PubChem CID 71498091) has the molecular formula C23H26N2O6S2 and a molecular weight of 490.60 g/mol. Its IUPAC name is 3-[(2-benzamido-3-ethoxy-3-oxopropyl)disulfanyl]-2-[(2-phenylacetyl)amino]propanoic acid.
| Compound Name | 3-[(2-benzamido-3-ethoxy-3-oxopropyl)disulfanyl]-2-[(2-phenylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 71498091 |
| Molecular Formula | C23H26N2O6S2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 3-[(2-benzamido-3-ethoxy-3-oxopropyl)disulfanyl]-2-[(2-phenylacetyl)amino]propanoic acid |
| SMILES | CCOC(=O)C(CSSCC(NC(=O)Cc1ccccc1)C(=O)O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O6S2/c1-2-31-23(30)19(25-21(27)17-11-7-4-8-12-17)15-33-32-14-18(22(28)29)24-20(26)13-16-9-5-3-6-10-16/h3-12,18-19H,2,13-15H2,1H3,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | MHASSVIEBAINPC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|