C18H15F2NO4S — CID 531403
methyl 2-[(4-fluorobenzoyl)amino]-3-(4-fluorobenzoyl)sulfanylpropanoate (PubChem CID 531403) has the molecular formula C18H15F2NO4S and a molecular weight of 379.38 g/mol. Its IUPAC name is methyl 2-[(4-fluorobenzoyl)amino]-3-(4-fluorobenzoyl)sulfanylpropanoate.
| Compound Name | methyl 2-[(4-fluorobenzoyl)amino]-3-(4-fluorobenzoyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 531403 |
| Molecular Formula | C18H15F2NO4S |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | methyl 2-[(4-fluorobenzoyl)amino]-3-(4-fluorobenzoyl)sulfanylpropanoate |
| SMILES | COC(=O)C(CSC(=O)c1ccc(F)cc1)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15F2NO4S/c1-25-17(23)15(21-16(22)11-2-6-13(19)7-3-11)10-26-18(24)12-4-8-14(20)9-5-12/h2-9,15H,10H2,1H3,(H,21,22) |
| InChIKey | JQBGTFYUBVJNAH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|