C18H11F6NO4S — CID 531428
methyl 2-[(2,3,4-trifluorobenzoyl)amino]-3-(2,3,4-trifluorobenzoyl)sulfanylpropanoate (PubChem CID 531428) has the molecular formula C18H11F6NO4S and a molecular weight of 451.34 g/mol. Its IUPAC name is methyl 2-[(2,3,4-trifluorobenzoyl)amino]-3-(2,3,4-trifluorobenzoyl)sulfanylpropanoate.
| Compound Name | methyl 2-[(2,3,4-trifluorobenzoyl)amino]-3-(2,3,4-trifluorobenzoyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 531428 |
| Molecular Formula | C18H11F6NO4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | methyl 2-[(2,3,4-trifluorobenzoyl)amino]-3-(2,3,4-trifluorobenzoyl)sulfanylpropanoate |
| SMILES | COC(=O)C(CSC(=O)c1ccc(F)c(F)c1F)NC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H11F6NO4S/c1-29-17(27)11(25-16(26)7-2-4-9(19)14(23)12(7)21)6-30-18(28)8-3-5-10(20)15(24)13(8)22/h2-5,11H,6H2,1H3,(H,25,26) |
| InChIKey | VRQOUSHWGOOMRB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|