C10H10F3NO3 — CID 87972282
2,3,4-trifluoro-N-(1-hydroxypropan-2-yloxy)benzamide (PubChem CID 87972282) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(1-hydroxypropan-2-yloxy)benzamide.
| Compound Name | 2,3,4-trifluoro-N-(1-hydroxypropan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 87972282 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2,3,4-trifluoro-N-(1-hydroxypropan-2-yloxy)benzamide |
| SMILES | CC(CO)ONC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H10F3NO3/c1-5(4-15)17-14-10(16)6-2-3-7(11)9(13)8(6)12/h2-3,5,15H,4H2,1H3,(H,14,16) |
| InChIKey | QWJMRJMZFYEDNM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|