C15H16F3N3O2 — CID 127054399
N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4-trifluorobenzamide (PubChem CID 127054399) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 127054399 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4-trifluorobenzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(F)c(F)c1F)C(=O)NCC#N |
| InChI | InChI=1S/C15H16F3N3O2/c1-8(2)7-11(15(23)20-6-5-19)21-14(22)9-3-4-10(16)13(18)12(9)17/h3-4,8,11H,6-7H2,1-2H3,(H,20,23)(H,21,22)/t11-/m0/s1 |
| InChIKey | BIXZCWNBIQGMHH-NSHDSACASA-N |
| XLogP | 1.89 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|