C16H22N4O2 — CID 85049886
3-(aminomethyl)-N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 85049886) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 3-(aminomethyl)-N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 85049886 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-(aminomethyl)-N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC(C)CC(NC(=O)c1cccc(CN)c1)C(=O)NCC#N |
| InChI | InChI=1S/C16H22N4O2/c1-11(2)8-14(16(22)19-7-6-17)20-15(21)13-5-3-4-12(9-13)10-18/h3-5,9,11,14H,7-8,10,18H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | NOGOTMIFGGUPTB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|