C14H18N4O3 — CID 87913020
N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 87913020) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87913020 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(=O)[nH]c1)C(=O)NCC#N |
| InChI | InChI=1S/C14H18N4O3/c1-9(2)7-11(14(21)16-6-5-15)18-13(20)10-3-4-12(19)17-8-10/h3-4,8-9,11H,6-7H2,1-2H3,(H,16,21)(H,17,19)(H,18,20) |
| InChIKey | YETSGDYOFPIXJN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|