C10H10N2O2 — CID 114389718
N-but-3-yn-2-yl-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 114389718) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is N-but-3-yn-2-yl-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-but-3-yn-2-yl-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114389718 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | N-but-3-yn-2-yl-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | C#CC(C)NC(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C10H10N2O2/c1-3-7(2)12-10(14)8-4-5-9(13)11-6-8/h1,4-7H,2H3,(H,11,13)(H,12,14) |
| InChIKey | XAMQIRSIUVULEH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|