C12H19N3O2 — CID 114178134
N-(1-amino-4-methylpentan-3-yl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 114178134) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-3-yl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(1-amino-4-methylpentan-3-yl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114178134 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-(1-amino-4-methylpentan-3-yl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | CC(C)C(CCN)NC(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C12H19N3O2/c1-8(2)10(5-6-13)15-12(17)9-3-4-11(16)14-7-9/h3-4,7-8,10H,5-6,13H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | IYSMBRJPQXWLNB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |