C26H34N4O4 — CID 132534144
1-N,4-N-bis[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)pentan-2-yl]benzene-1,4-dicarboxamide (PubChem CID 132534144) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 1-N,4-N-bis[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)pentan-2-yl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)pentan-2-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 132534144 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 1-N,4-N-bis[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)pentan-2-yl]benzene-1,4-dicarboxamide |
| SMILES | C#CCNC(=O)[C@H](CC(C)C)NC(=O)c1ccc(C(=O)N[C@@H](CC(C)C)C(=O)NCC#C)cc1 |
| InChI | InChI=1S/C26H34N4O4/c1-7-13-27-25(33)21(15-17(3)4)29-23(31)19-9-11-20(12-10-19)24(32)30-22(16-18(5)6)26(34)28-14-8-2/h1-2,9-12,17-18,21-22H,13-16H2,3-6H3,(H,27,33)(H,28,34)(H,29,31)(H,30,32)/t21-,22-/m0/s1 |
| InChIKey | PSHHVALOWITXLN-VXKWHMMOSA-N |
| XLogP | 1.47 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|