C17H21FN2O2 — CID 46700845
4-fluoro-N-[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)hexan-2-yl]benzamide (PubChem CID 46700845) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-fluoro-N-[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)hexan-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)hexan-2-yl]benzamide |
|---|---|
| PubChem CID | 46700845 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-fluoro-N-[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)hexan-2-yl]benzamide |
| SMILES | C#CCNC(=O)[C@H](CC(C)CC)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN2O2/c1-4-10-19-17(22)15(11-12(3)5-2)20-16(21)13-6-8-14(18)9-7-13/h1,6-9,12,15H,5,10-11H2,2-3H3,(H,19,22)(H,20,21)/t12?,15-/m0/s1 |
| InChIKey | JIHCSRDGHDQABE-CVRLYYSRSA-N |
| XLogP | 2.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|