C23H28N4O3 — CID 87952895
N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-[3-(dimethylamino)phenoxy]benzamide (PubChem CID 87952895) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-[3-(dimethylamino)phenoxy]benzamide.
| Compound Name | N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-[3-(dimethylamino)phenoxy]benzamide |
|---|---|
| PubChem CID | 87952895 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-[3-(dimethylamino)phenoxy]benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(Oc2cccc(N(C)C)c2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C23H28N4O3/c1-16(2)14-21(23(29)25-13-12-24)26-22(28)17-8-10-19(11-9-17)30-20-7-5-6-18(15-20)27(3)4/h5-11,15-16,21H,13-14H2,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | CWAFRZRDOFALKX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|