C21H24N6O3 — CID 18186667
N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-3-(pyridin-2-ylcarbamoylamino)benzamide (PubChem CID 18186667) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-3-(pyridin-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-3-(pyridin-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 18186667 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-3-(pyridin-2-ylcarbamoylamino)benzamide |
| SMILES | CC(C)CC(NC(=O)c1cccc(NC(=O)Nc2ccccn2)c1)C(=O)NCC#N |
| InChI | InChI=1S/C21H24N6O3/c1-14(2)12-17(20(29)24-11-9-22)26-19(28)15-6-5-7-16(13-15)25-21(30)27-18-8-3-4-10-23-18/h3-8,10,13-14,17H,11-12H2,1-2H3,(H,24,29)(H,26,28)(H2,23,25,27,30) |
| InChIKey | KOUXXQSBRWTPSF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 136.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|