C17H14N4O4 — CID 98142120
methyl N-[3-[(2R)-2-cyano-3-oxo-3-(pyridin-2-ylamino)propanoyl]phenyl]carbamate (PubChem CID 98142120) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is methyl N-[3-[(2R)-2-cyano-3-oxo-3-(pyridin-2-ylamino)propanoyl]phenyl]carbamate.
| Compound Name | methyl N-[3-[(2R)-2-cyano-3-oxo-3-(pyridin-2-ylamino)propanoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 98142120 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | methyl N-[3-[(2R)-2-cyano-3-oxo-3-(pyridin-2-ylamino)propanoyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(C(=O)[C@@H](C#N)C(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C17H14N4O4/c1-25-17(24)20-12-6-4-5-11(9-12)15(22)13(10-18)16(23)21-14-7-2-3-8-19-14/h2-9,13H,1H3,(H,20,24)(H,19,21,23)/t13-/m1/s1 |
| InChIKey | ZGABQQKTGBNNPM-CYBMUJFWSA-N |
| XLogP | 2.22 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|