C17H15N3O3 — CID 98506852
(2R)-2-cyano-4-(3-methylphenoxy)-3-oxo-N-pyridin-2-ylbutanamide (PubChem CID 98506852) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is (2R)-2-cyano-4-(3-methylphenoxy)-3-oxo-N-pyridin-2-ylbutanamide.
| Compound Name | (2R)-2-cyano-4-(3-methylphenoxy)-3-oxo-N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 98506852 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2R)-2-cyano-4-(3-methylphenoxy)-3-oxo-N-pyridin-2-ylbutanamide |
| SMILES | Cc1cccc(OCC(=O)[C@@H](C#N)C(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C17H15N3O3/c1-12-5-4-6-13(9-12)23-11-15(21)14(10-18)17(22)20-16-7-2-3-8-19-16/h2-9,14H,11H2,1H3,(H,19,20,22)/t14-/m1/s1 |
| InChIKey | DDYSOIWLAPYORE-CQSZACIVSA-N |
| XLogP | 2.12 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|