C16H21N5O3 — CID 87953139
3-(carbamoylamino)-N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 87953139) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 3-(carbamoylamino)-N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 87953139 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3-(carbamoylamino)-N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC(C)CC(NC(=O)c1cccc(NC(N)=O)c1)C(=O)N(C)C#N |
| InChI | InChI=1S/C16H21N5O3/c1-10(2)7-13(15(23)21(3)9-17)20-14(22)11-5-4-6-12(8-11)19-16(18)24/h4-6,8,10,13H,7H2,1-3H3,(H,20,22)(H3,18,19,24) |
| InChIKey | JZQVZZBZHMUIQV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|