C14H18N4O3 — CID 90820866
N-[(2R)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 90820866) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[(2R)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-[(2R)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90820866 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[(2R)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | CC(C)C[C@@H](NC(=O)c1cccc(=O)[nH]1)C(=O)N(C)C#N |
| InChI | InChI=1S/C14H18N4O3/c1-9(2)7-11(14(21)18(3)8-15)17-13(20)10-5-4-6-12(19)16-10/h4-6,9,11H,7H2,1-3H3,(H,16,19)(H,17,20)/t11-/m1/s1 |
| InChIKey | FVXAYXCPXNQKGR-LLVKDONJSA-N |
| XLogP | 0.46 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|