C23H25N3O4 — CID 87912937
3-[4-[[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]-4-methylbenzoic acid (PubChem CID 87912937) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-[4-[[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]-4-methylbenzoic acid.
| Compound Name | 3-[4-[[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 87912937 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3-[4-[[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-c1ccc(C(=O)N[C@@H](CC(C)C)C(=O)N(C)C#N)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-14(2)11-20(22(28)26(4)13-24)25-21(27)17-9-7-16(8-10-17)19-12-18(23(29)30)6-5-15(19)3/h5-10,12,14,20H,11H2,1-4H3,(H,25,27)(H,29,30)/t20-/m0/s1 |
| InChIKey | MYMVUXBWUBOKDR-FQEVSTJZSA-N |
| XLogP | 3.44 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|