C22H31N5O5 — CID 87953171
2-morpholin-4-ylethyl N-[4-[[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]carbamate (PubChem CID 87953171) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl N-[4-[[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]carbamate.
| Compound Name | 2-morpholin-4-ylethyl N-[4-[[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 87953171 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 2-morpholin-4-ylethyl N-[4-[[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]carbamate |
| SMILES | CC(C)CC(NC(=O)c1ccc(NC(=O)OCCN2CCOCC2)cc1)C(=O)N(C)C#N |
| InChI | InChI=1S/C22H31N5O5/c1-16(2)14-19(21(29)26(3)15-23)25-20(28)17-4-6-18(7-5-17)24-22(30)32-13-10-27-8-11-31-12-9-27/h4-7,16,19H,8-14H2,1-3H3,(H,24,30)(H,25,28) |
| InChIKey | PQYXWZFZZBWPNS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|