C21H20Cl3N3O2 — CID 87912969
3-chloro-N-[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-4-(2,6-dichlorophenyl)benzamide (PubChem CID 87912969) has the molecular formula C21H20Cl3N3O2 and a molecular weight of 452.77 g/mol. Its IUPAC name is 3-chloro-N-[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-4-(2,6-dichlorophenyl)benzamide.
| Compound Name | 3-chloro-N-[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-4-(2,6-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 87912969 |
| Molecular Formula | C21H20Cl3N3O2 |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 3-chloro-N-[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-4-(2,6-dichlorophenyl)benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(-c2c(Cl)cccc2Cl)c(Cl)c1)C(=O)N(C)C#N |
| InChI | InChI=1S/C21H20Cl3N3O2/c1-12(2)9-18(21(29)27(3)11-25)26-20(28)13-7-8-14(17(24)10-13)19-15(22)5-4-6-16(19)23/h4-8,10,12,18H,9H2,1-3H3,(H,26,28)/t18-/m0/s1 |
| InChIKey | KGIFYAXJIRSXJP-SFHVURJKSA-N |
| XLogP | 5.40 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|