C16H21BrN4O2 — CID 71551040
3-bromo-N-[(2S)-1-[[cyano(methyl)amino]-methylamino]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 71551040) has the molecular formula C16H21BrN4O2 and a molecular weight of 381.27 g/mol. Its IUPAC name is 3-bromo-N-[(2S)-1-[[cyano(methyl)amino]-methylamino]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 3-bromo-N-[(2S)-1-[[cyano(methyl)amino]-methylamino]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 71551040 |
| Molecular Formula | C16H21BrN4O2 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-bromo-N-[(2S)-1-[[cyano(methyl)amino]-methylamino]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1cccc(Br)c1)C(=O)N(C)N(C)C#N |
| InChI | InChI=1S/C16H21BrN4O2/c1-11(2)8-14(16(23)21(4)20(3)10-18)19-15(22)12-6-5-7-13(17)9-12/h5-7,9,11,14H,8H2,1-4H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | OFMCMEIBGCSICG-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|