C21H25N5O4 — CID 87953602
N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-3-(furan-2-ylmethylcarbamoylamino)benzamide (PubChem CID 87953602) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-3-(furan-2-ylmethylcarbamoylamino)benzamide.
| Compound Name | N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-3-(furan-2-ylmethylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 87953602 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-3-(furan-2-ylmethylcarbamoylamino)benzamide |
| SMILES | CC(C)CC(NC(=O)c1cccc(NC(=O)NCc2ccco2)c1)C(=O)N(C)C#N |
| InChI | InChI=1S/C21H25N5O4/c1-14(2)10-18(20(28)26(3)13-22)25-19(27)15-6-4-7-16(11-15)24-21(29)23-12-17-8-5-9-30-17/h4-9,11,14,18H,10,12H2,1-3H3,(H,25,27)(H2,23,24,29) |
| InChIKey | GMKPPBIJAAURIO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|