C23H23N3O4 — CID 87913003
N-[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-3,5-bis(furan-2-yl)benzamide (PubChem CID 87913003) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-3,5-bis(furan-2-yl)benzamide.
| Compound Name | N-[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-3,5-bis(furan-2-yl)benzamide |
|---|---|
| PubChem CID | 87913003 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-3,5-bis(furan-2-yl)benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1cc(-c2ccco2)cc(-c2ccco2)c1)C(=O)N(C)C#N |
| InChI | InChI=1S/C23H23N3O4/c1-15(2)10-19(23(28)26(3)14-24)25-22(27)18-12-16(20-6-4-8-29-20)11-17(13-18)21-7-5-9-30-21/h4-9,11-13,15,19H,10H2,1-3H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | NTQLROJAPVRRRC-IBGZPJMESA-N |
| XLogP | 4.29 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|