C22H21Cl2N3O4 — CID 87912957
4-chloro-3-[3-chloro-4-[[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]benzoic acid (PubChem CID 87912957) has the molecular formula C22H21Cl2N3O4 and a molecular weight of 462.33 g/mol. Its IUPAC name is 4-chloro-3-[3-chloro-4-[[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]benzoic acid.
| Compound Name | 4-chloro-3-[3-chloro-4-[[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 87912957 |
| Molecular Formula | C22H21Cl2N3O4 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 4-chloro-3-[3-chloro-4-[[(2S)-1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]phenyl]benzoic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(-c2cc(C(=O)O)ccc2Cl)cc1Cl)C(=O)N(C)C#N |
| InChI | InChI=1S/C22H21Cl2N3O4/c1-12(2)8-19(21(29)27(3)11-25)26-20(28)15-6-4-13(10-18(15)24)16-9-14(22(30)31)5-7-17(16)23/h4-7,9-10,12,19H,8H2,1-3H3,(H,26,28)(H,30,31)/t19-/m0/s1 |
| InChIKey | BPNYHXQILPOKOE-IBGZPJMESA-N |
| XLogP | 4.44 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|