C18H21N7O3S — CID 87953624
N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-4-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzamide (PubChem CID 87953624) has the molecular formula C18H21N7O3S and a molecular weight of 415.48 g/mol. Its IUPAC name is N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-4-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-4-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 87953624 |
| Molecular Formula | C18H21N7O3S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[1-[cyano(methyl)amino]-4-methyl-1-oxopentan-2-yl]-4-(1,3,4-thiadiazol-2-ylcarbamoylamino)benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(NC(=O)Nc2nncs2)cc1)C(=O)N(C)C#N |
| InChI | InChI=1S/C18H21N7O3S/c1-11(2)8-14(16(27)25(3)9-19)22-15(26)12-4-6-13(7-5-12)21-17(28)23-18-24-20-10-29-18/h4-7,10-11,14H,8H2,1-3H3,(H,22,26)(H2,21,23,24,28) |
| InChIKey | LBFAZXLPPRSWKT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|