C20H24N4O2S — CID 71550994
N-[(2S)-1-[[cyano(methyl)amino]-methylamino]-4-methyl-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide (PubChem CID 71550994) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[(2S)-1-[[cyano(methyl)amino]-methylamino]-4-methyl-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide.
| Compound Name | N-[(2S)-1-[[cyano(methyl)amino]-methylamino]-4-methyl-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 71550994 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[(2S)-1-[[cyano(methyl)amino]-methylamino]-4-methyl-1-oxopentan-2-yl]-4-thiophen-2-ylbenzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(-c2cccs2)cc1)C(=O)N(C)N(C)C#N |
| InChI | InChI=1S/C20H24N4O2S/c1-14(2)12-17(20(26)24(4)23(3)13-21)22-19(25)16-9-7-15(8-10-16)18-6-5-11-27-18/h5-11,14,17H,12H2,1-4H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | QTYGQCXFALYGDZ-KRWDZBQOSA-N |
| XLogP | 3.35 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|