C11H15N3O3 — CID 114040306
N-[1-(ethylamino)-1-oxopropan-2-yl]-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 114040306) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is N-[1-(ethylamino)-1-oxopropan-2-yl]-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-[1-(ethylamino)-1-oxopropan-2-yl]-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114040306 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-[1-(ethylamino)-1-oxopropan-2-yl]-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | CCNC(=O)C(C)NC(=O)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C11H15N3O3/c1-3-12-10(16)7(2)13-11(17)8-5-4-6-9(15)14-8/h4-7H,3H2,1-2H3,(H,12,16)(H,13,17)(H,14,15) |
| InChIKey | LUCPOLDTDZJKMI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |