C17H17NO5 — CID 9277490
methyl (2S)-3-hydroxy-2-[(3-phenoxybenzoyl)amino]propanoate (PubChem CID 9277490) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is methyl (2S)-3-hydroxy-2-[(3-phenoxybenzoyl)amino]propanoate.
| Compound Name | methyl (2S)-3-hydroxy-2-[(3-phenoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 9277490 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl (2S)-3-hydroxy-2-[(3-phenoxybenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C17H17NO5/c1-22-17(21)15(11-19)18-16(20)12-6-5-9-14(10-12)23-13-7-3-2-4-8-13/h2-10,15,19H,11H2,1H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | ZONPWSLDCSHJDH-HNNXBMFYSA-N |
| XLogP | 1.74 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |