C15H22N2O3 — CID 82546362
methyl 2-[[3-(aminomethyl)benzoyl]amino]-4-methylpentanoate (PubChem CID 82546362) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 2-[[3-(aminomethyl)benzoyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[3-(aminomethyl)benzoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 82546362 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | methyl 2-[[3-(aminomethyl)benzoyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-10(2)7-13(15(19)20-3)17-14(18)12-6-4-5-11(8-12)9-16/h4-6,8,10,13H,7,9,16H2,1-3H3,(H,17,18) |
| InChIKey | URUNLVUTPLYAMW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |