C35H37NO6 — CID 142728752
methyl 4-methyl-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]pentanoate (PubChem CID 142728752) has the molecular formula C35H37NO6 and a molecular weight of 567.68 g/mol. Its IUPAC name is methyl 4-methyl-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 142728752 |
| Molecular Formula | C35H37NO6 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | methyl 4-methyl-2-[[3,4,5-tris(phenylmethoxy)benzoyl]amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C35H37NO6/c1-25(2)19-30(35(38)39-3)36-34(37)29-20-31(40-22-26-13-7-4-8-14-26)33(42-24-28-17-11-6-12-18-28)32(21-29)41-23-27-15-9-5-10-16-27/h4-18,20-21,25,30H,19,22-24H2,1-3H3,(H,36,37) |
| InChIKey | PBMVBVOJERPIOT-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |