C14H14F3NO5S — CID 44516254
methyl (2R)-2-acetamido-3-[2-hydroxy-4-(trifluoromethyl)benzoyl]sulfanylpropanoate (PubChem CID 44516254) has the molecular formula C14H14F3NO5S and a molecular weight of 365.33 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-[2-hydroxy-4-(trifluoromethyl)benzoyl]sulfanylpropanoate.
| Compound Name | methyl (2R)-2-acetamido-3-[2-hydroxy-4-(trifluoromethyl)benzoyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 44516254 |
| Molecular Formula | C14H14F3NO5S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | methyl (2R)-2-acetamido-3-[2-hydroxy-4-(trifluoromethyl)benzoyl]sulfanylpropanoate |
| SMILES | COC(=O)[C@H](CSC(=O)c1ccc(C(F)(F)F)cc1O)NC(C)=O |
| InChI | InChI=1S/C14H14F3NO5S/c1-7(19)18-10(12(21)23-2)6-24-13(22)9-4-3-8(5-11(9)20)14(15,16)17/h3-5,10,20H,6H2,1-2H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | IIHPBYAUVZHTAC-JTQLQIEISA-N |
| XLogP | 1.96 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|