C9H17NO3S — CID 58759760
methyl 2-acetamido-3-propan-2-ylsulfanylpropanoate (PubChem CID 58759760) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is methyl 2-acetamido-3-propan-2-ylsulfanylpropanoate.
| Compound Name | methyl 2-acetamido-3-propan-2-ylsulfanylpropanoate |
|---|---|
| PubChem CID | 58759760 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | methyl 2-acetamido-3-propan-2-ylsulfanylpropanoate |
| SMILES | COC(=O)C(CSC(C)C)NC(C)=O |
| InChI | InChI=1S/C9H17NO3S/c1-6(2)14-5-8(9(12)13-4)10-7(3)11/h6,8H,5H2,1-4H3,(H,10,11) |
| InChIKey | DRLCBFHDUOQUCJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |