C10H14N2O5S — CID 118001317
methyl (2S)-2-acetamido-3-(1-cyano-2-methoxy-2-oxoethyl)sulfanylpropanoate (PubChem CID 118001317) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-3-(1-cyano-2-methoxy-2-oxoethyl)sulfanylpropanoate.
| Compound Name | methyl (2S)-2-acetamido-3-(1-cyano-2-methoxy-2-oxoethyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 118001317 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | methyl (2S)-2-acetamido-3-(1-cyano-2-methoxy-2-oxoethyl)sulfanylpropanoate |
| SMILES | COC(=O)C(C#N)SC[C@@H](NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C10H14N2O5S/c1-6(13)12-7(9(14)16-2)5-18-8(4-11)10(15)17-3/h7-8H,5H2,1-3H3,(H,12,13)/t7-,8?/m1/s1 |
| InChIKey | OFPPELAGIZDMNX-GVHYBUMESA-N |
| XLogP | -0.54 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |