C12H21N3O5S2 — CID 155380964
methyl (2R)-2-acetamido-3-[[(2R)-2-acetamido-3-(methylamino)-3-oxopropyl]disulfanyl]propanoate (PubChem CID 155380964) has the molecular formula C12H21N3O5S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-[[(2R)-2-acetamido-3-(methylamino)-3-oxopropyl]disulfanyl]propanoate.
| Compound Name | methyl (2R)-2-acetamido-3-[[(2R)-2-acetamido-3-(methylamino)-3-oxopropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 155380964 |
| Molecular Formula | C12H21N3O5S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | methyl (2R)-2-acetamido-3-[[(2R)-2-acetamido-3-(methylamino)-3-oxopropyl]disulfanyl]propanoate |
| SMILES | CNC(=O)[C@H](CSSC[C@H](NC(C)=O)C(=O)OC)NC(C)=O |
| InChI | InChI=1S/C12H21N3O5S2/c1-7(16)14-9(11(18)13-3)5-21-22-6-10(12(19)20-4)15-8(2)17/h9-10H,5-6H2,1-4H3,(H,13,18)(H,14,16)(H,15,17)/t9-,10-/m0/s1 |
| InChIKey | XHZHQTITHIOKCE-UWVGGRQHSA-N |
| XLogP | -0.70 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|