C6H11N3O3S — CID 89275978
(2R)-2-acetamido-N-methyl-3-nitrososulfanylpropanamide (PubChem CID 89275978) has the molecular formula C6H11N3O3S and a molecular weight of 205.24 g/mol. Its IUPAC name is (2R)-2-acetamido-N-methyl-3-nitrososulfanylpropanamide.
| Compound Name | (2R)-2-acetamido-N-methyl-3-nitrososulfanylpropanamide |
|---|---|
| PubChem CID | 89275978 |
| Molecular Formula | C6H11N3O3S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | (2R)-2-acetamido-N-methyl-3-nitrososulfanylpropanamide |
| SMILES | CNC(=O)[C@H](CSN=O)NC(C)=O |
| InChI | InChI=1S/C6H11N3O3S/c1-4(10)8-5(3-13-9-12)6(11)7-2/h5H,3H2,1-2H3,(H,7,11)(H,8,10)/t5-/m0/s1 |
| InChIKey | ZCLPNRYVXJTFPK-YFKPBYRVSA-N |
| XLogP | -0.35 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|