C8H16N2O3P+ — CID 72538863
[3-acetamido-4-(methylamino)-4-oxobutyl]-methyl-oxophosphanium (PubChem CID 72538863) has the molecular formula C8H16N2O3P+ and a molecular weight of 219.20 g/mol. Its IUPAC name is [3-acetamido-4-(methylamino)-4-oxobutyl]-methyl-oxophosphanium.
| Compound Name | [3-acetamido-4-(methylamino)-4-oxobutyl]-methyl-oxophosphanium |
|---|---|
| PubChem CID | 72538863 |
| Molecular Formula | C8H16N2O3P+ |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | [3-acetamido-4-(methylamino)-4-oxobutyl]-methyl-oxophosphanium |
| SMILES | CNC(=O)C(CC[P+](C)=O)NC(C)=O |
| InChI | InChI=1S/C8H15N2O3P/c1-6(11)10-7(8(12)9-2)4-5-14(3)13/h7H,4-5H2,1-3H3,(H-,9,10,11,12)/p+1 |
| InChIKey | XTYBURRRDOVKPN-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|