C8H14N2O3S — CID 130369900
S-[2-acetamido-3-(methylamino)-3-oxopropyl] ethanethioate (PubChem CID 130369900) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is S-[2-acetamido-3-(methylamino)-3-oxopropyl] ethanethioate.
| Compound Name | S-[2-acetamido-3-(methylamino)-3-oxopropyl] ethanethioate |
|---|---|
| PubChem CID | 130369900 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | S-[2-acetamido-3-(methylamino)-3-oxopropyl] ethanethioate |
| SMILES | CNC(=O)C(CSC(C)=O)NC(C)=O |
| InChI | InChI=1S/C8H14N2O3S/c1-5(11)10-7(8(13)9-3)4-14-6(2)12/h7H,4H2,1-3H3,(H,9,13)(H,10,11) |
| InChIKey | GGSZMGIRAOFXPW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|