C12H21N3O3S — CID 24952890
S-[(2R)-2-acetamido-3-(4-methylpiperazin-1-yl)-3-oxopropyl] ethanethioate (PubChem CID 24952890) has the molecular formula C12H21N3O3S and a molecular weight of 287.38 g/mol. Its IUPAC name is S-[(2R)-2-acetamido-3-(4-methylpiperazin-1-yl)-3-oxopropyl] ethanethioate.
| Compound Name | S-[(2R)-2-acetamido-3-(4-methylpiperazin-1-yl)-3-oxopropyl] ethanethioate |
|---|---|
| PubChem CID | 24952890 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | S-[(2R)-2-acetamido-3-(4-methylpiperazin-1-yl)-3-oxopropyl] ethanethioate |
| SMILES | CC(=O)N[C@@H](CSC(C)=O)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H21N3O3S/c1-9(16)13-11(8-19-10(2)17)12(18)15-6-4-14(3)5-7-15/h11H,4-8H2,1-3H3,(H,13,16)/t11-/m0/s1 |
| InChIKey | MKEFOJXYRJVFRP-NSHDSACASA-N |
| XLogP | -0.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|