C10H19N3O2S — CID 24952547
N-[(2R)-1-(4-methylpiperazin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide (PubChem CID 24952547) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is N-[(2R)-1-(4-methylpiperazin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide.
| Compound Name | N-[(2R)-1-(4-methylpiperazin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 24952547 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-[(2R)-1-(4-methylpiperazin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](CS)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C10H19N3O2S/c1-8(14)11-9(7-16)10(15)13-5-3-12(2)4-6-13/h9,16H,3-7H2,1-2H3,(H,11,14)/t9-/m0/s1 |
| InChIKey | BHMLQJRVFABPLN-VIFPVBQESA-N |
| XLogP | -0.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|