About N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide
N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide (PubChem CID 107769489) has the molecular formula C12H22N2O2S
and a molecular weight of 258.39 g/mol. Its IUPAC name is N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide |
| PubChem CID | 107769489 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide |
| SMILES | CC(=O)NC(CS)C(=O)N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C12H22N2O2S/c1-9(15)13-10(8-17)11(16)14-6-4-12(2,3)5-7-14/h10,17H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | YJAUAFUMDIFIME-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide?
The IUPAC name of N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide (CID 107769489) is N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide.
What is the SMILES notation for N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide?
The canonical SMILES for N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide is CC(=O)NC(CS)C(=O)N1CCC(C)(C)CC1.
What is the InChIKey of N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide?
The InChIKey is YJAUAFUMDIFIME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2S/c1-9(15)13-10(8-17)11(16)14-6-4-12(2,3)5-7-14/h10,17H,4-8H2,1-3H3,(H,13,15).
What are the key properties of N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide?
N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide has a molecular weight of 258.39 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4,4-dimethylpiperidin-1-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide is sourced from PubChem (CID 107769489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).