C11H19N3O3S — CID 114082531
1-(2-acetamido-3-sulfanylpropanoyl)-3-methylpyrrolidine-3-carboxamide (PubChem CID 114082531) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-(2-acetamido-3-sulfanylpropanoyl)-3-methylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2-acetamido-3-sulfanylpropanoyl)-3-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 114082531 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-(2-acetamido-3-sulfanylpropanoyl)-3-methylpyrrolidine-3-carboxamide |
| SMILES | CC(=O)NC(CS)C(=O)N1CCC(C)(C(N)=O)C1 |
| InChI | InChI=1S/C11H19N3O3S/c1-7(15)13-8(5-18)9(16)14-4-3-11(2,6-14)10(12)17/h8,18H,3-6H2,1-2H3,(H2,12,17)(H,13,15) |
| InChIKey | NJSFMNTWVSWBRI-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|