C13H22N2O4 — CID 114082415
2-(3-carbamoyl-3-methylpyrrolidine-1-carbonyl)-3,3-dimethylbutanoic acid (PubChem CID 114082415) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(3-carbamoyl-3-methylpyrrolidine-1-carbonyl)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(3-carbamoyl-3-methylpyrrolidine-1-carbonyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 114082415 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-(3-carbamoyl-3-methylpyrrolidine-1-carbonyl)-3,3-dimethylbutanoic acid |
| SMILES | CC1(C(N)=O)CCN(C(=O)C(C(=O)O)C(C)(C)C)C1 |
| InChI | InChI=1S/C13H22N2O4/c1-12(2,3)8(10(17)18)9(16)15-6-5-13(4,7-15)11(14)19/h8H,5-7H2,1-4H3,(H2,14,19)(H,17,18) |
| InChIKey | SEMYNWHIAQQIKC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|