C12H20N2O4 — CID 114081822
ethyl 4-(3-carbamoyl-3-methylpyrrolidin-1-yl)-4-oxobutanoate (PubChem CID 114081822) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is ethyl 4-(3-carbamoyl-3-methylpyrrolidin-1-yl)-4-oxobutanoate.
| Compound Name | ethyl 4-(3-carbamoyl-3-methylpyrrolidin-1-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 114081822 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | ethyl 4-(3-carbamoyl-3-methylpyrrolidin-1-yl)-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCC(C)(C(N)=O)C1 |
| InChI | InChI=1S/C12H20N2O4/c1-3-18-10(16)5-4-9(15)14-7-6-12(2,8-14)11(13)17/h3-8H2,1-2H3,(H2,13,17) |
| InChIKey | QZSQFJLSHGUSAD-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |