C10H17NO5 — CID 106668262
ethyl 4-(3,4-dihydroxypyrrolidin-1-yl)-4-oxobutanoate (PubChem CID 106668262) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is ethyl 4-(3,4-dihydroxypyrrolidin-1-yl)-4-oxobutanoate.
| Compound Name | ethyl 4-(3,4-dihydroxypyrrolidin-1-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 106668262 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | ethyl 4-(3,4-dihydroxypyrrolidin-1-yl)-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H17NO5/c1-2-16-10(15)4-3-9(14)11-5-7(12)8(13)6-11/h7-8,12-13H,2-6H2,1H3 |
| InChIKey | MUIXTSJECMNSHI-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |