C10H19NO3 — CID 79410087
1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]hexan-1-one (PubChem CID 79410087) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]hexan-1-one.
| Compound Name | 1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 79410087 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 1-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H19NO3/c1-2-3-4-5-10(14)11-6-8(12)9(13)7-11/h8-9,12-13H,2-7H2,1H3/t8-,9+ |
| InChIKey | CMPZEYNAHWGPAI-DTORHVGOSA-N |
| XLogP | 0.13 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|