C10H19NO3S — CID 106671630
2-butylsulfanyl-1-(3,4-dihydroxypyrrolidin-1-yl)ethanone (PubChem CID 106671630) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is 2-butylsulfanyl-1-(3,4-dihydroxypyrrolidin-1-yl)ethanone.
| Compound Name | 2-butylsulfanyl-1-(3,4-dihydroxypyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 106671630 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-butylsulfanyl-1-(3,4-dihydroxypyrrolidin-1-yl)ethanone |
| SMILES | CCCCSCC(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H19NO3S/c1-2-3-4-15-7-10(14)11-5-8(12)9(13)6-11/h8-9,12-13H,2-7H2,1H3 |
| InChIKey | YFBVUHWESUNCKR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|