C10H18FNO2 — CID 146509986
1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]hexan-1-one (PubChem CID 146509986) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]hexan-1-one.
| Compound Name | 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 146509986 |
| Molecular Formula | C10H18FNO2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1C[C@@H](O)[C@H](F)C1 |
| InChI | InChI=1S/C10H18FNO2/c1-2-3-4-5-10(14)12-6-8(11)9(13)7-12/h8-9,13H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | VULORZZUIYGRFK-RKDXNWHRSA-N |
| XLogP | 1.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|