About 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one
1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one (PubChem CID 122536398) has the molecular formula C7H12FNO2
and a molecular weight of 161.17 g/mol. Its IUPAC name is 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one |
| PubChem CID | 122536398 |
| Molecular Formula | C7H12FNO2 |
| Molecular Weight | 161.17 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1C[C@@H]([C@H](C1)F)O |
| InChI | InChI=1S/C7H12FNO2/c1-2-7(11)9-3-5(8)6(10)4-9/h5-6,10H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | HXSGDBJMSUJGSR-WDSKDSINSA-N |
| XLogP | -0.20 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 163 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.17 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one?
The IUPAC name of 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one (CID 122536398) is 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one.
What is the SMILES notation for 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one?
The canonical SMILES for 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one is CCC(=O)N1C[C@@H]([C@H](C1)F)O.
What is the InChIKey of 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one?
The InChIKey is HXSGDBJMSUJGSR-WDSKDSINSA-N. The full InChI is InChI=1S/C7H12FNO2/c1-2-7(11)9-3-5(8)6(10)4-9/h5-6,10H,2-4H2,1H3/t5-,6-/m0/s1.
What are the key properties of 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one?
1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one has a molecular weight of 161.17 g/mol, XLogP of -0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]propan-1-one is sourced from PubChem (CID 122536398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).